C16H20IN3O2 — CID 171981064
N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]-4-iodobenzamide (PubChem CID 171981064) has the molecular formula C16H20IN3O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]-4-iodobenzamide.
| Compound Name | N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]-4-iodobenzamide |
|---|---|
| PubChem CID | 171981064 |
| Molecular Formula | C16H20IN3O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]-4-iodobenzamide |
| SMILES | C/C(CC(=O)NC1CCCC1)=N\NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H20IN3O2/c1-11(10-15(21)18-14-4-2-3-5-14)19-20-16(22)12-6-8-13(17)9-7-12/h6-9,14H,2-5,10H2,1H3,(H,18,21)(H,20,22)/b19-11+ |
| InChIKey | HUBGVYLVTKLXCF-YBFXNURJSA-N |
| XLogP | 2.85 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|