C14H25N3O3 — CID 6141635
tert-butyl N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]carbamate (PubChem CID 6141635) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 6141635 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl N-[(E)-[4-(cyclopentylamino)-4-oxobutan-2-ylidene]amino]carbamate |
| SMILES | C/C(CC(=O)NC1CCCC1)=N\NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O3/c1-10(16-17-13(19)20-14(2,3)4)9-12(18)15-11-7-5-6-8-11/h11H,5-9H2,1-4H3,(H,15,18)(H,17,19)/b16-10+ |
| InChIKey | ZAGMCUXLZPULAS-MHWRWJLKSA-N |
| XLogP | 2.34 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|