C9H18N2O2 — CID 124927744
tert-butyl N-[(Z)-butan-2-ylideneamino]carbamate (PubChem CID 124927744) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is tert-butyl N-[(Z)-butan-2-ylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-butan-2-ylideneamino]carbamate |
|---|---|
| PubChem CID | 124927744 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | tert-butyl N-[(Z)-butan-2-ylideneamino]carbamate |
| SMILES | CC/C(C)=N\NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-6-7(2)10-11-8(12)13-9(3,4)5/h6H2,1-5H3,(H,11,12)/b10-7- |
| InChIKey | SRDPPBNJUNAGNM-YFHOEESVSA-N |
| XLogP | 2.30 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|