C10H17N3O5 — CID 88925296
(2Z)-3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoic acid (PubChem CID 88925296) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2Z)-3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoic acid.
| Compound Name | (2Z)-3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 88925296 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2Z)-3-acetamido-2-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]propanoic acid |
| SMILES | CC(=O)NC/C(=N/NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H17N3O5/c1-6(14)11-5-7(8(15)16)12-13-9(17)18-10(2,3)4/h5H2,1-4H3,(H,11,14)(H,13,17)(H,15,16)/b12-7- |
| InChIKey | IIZDKJOZBOSRNA-GHXNOFRVSA-N |
| XLogP | 0.09 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|