C17H26N2O4 — CID 9074564
tert-butyl N-[(Z)-1-(3,4-diethoxyphenyl)ethylideneamino]carbamate (PubChem CID 9074564) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-(3,4-diethoxyphenyl)ethylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-(3,4-diethoxyphenyl)ethylideneamino]carbamate |
|---|---|
| PubChem CID | 9074564 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[(Z)-1-(3,4-diethoxyphenyl)ethylideneamino]carbamate |
| SMILES | CCOc1ccc(/C(C)=N\NC(=O)OC(C)(C)C)cc1OCC |
| InChI | InChI=1S/C17H26N2O4/c1-7-21-14-10-9-13(11-15(14)22-8-2)12(3)18-19-16(20)23-17(4,5)6/h9-11H,7-8H2,1-6H3,(H,19,20)/b18-12- |
| InChIKey | FRWQNYJCVOTTKW-PDGQHHTCSA-N |
| XLogP | 3.73 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|