C17H26N2O5 — CID 131632770
tert-butyl N-[2-(3,4-diethoxyphenyl)-2-hydroxyiminoethyl]carbamate (PubChem CID 131632770) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-diethoxyphenyl)-2-hydroxyiminoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-diethoxyphenyl)-2-hydroxyiminoethyl]carbamate |
|---|---|
| PubChem CID | 131632770 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl N-[2-(3,4-diethoxyphenyl)-2-hydroxyiminoethyl]carbamate |
| SMILES | CCOc1ccc(C(CNC(=O)OC(C)(C)C)=NO)cc1OCC |
| InChI | InChI=1S/C17H26N2O5/c1-6-22-14-9-8-12(10-15(14)23-7-2)13(19-21)11-18-16(20)24-17(3,4)5/h8-10,21H,6-7,11H2,1-5H3,(H,18,20) |
| InChIKey | JEEUEZGTGGKABL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|