C15H21NO5 — CID 16740549
tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]carbamate (PubChem CID 16740549) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 16740549 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl N-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]carbamate |
| SMILES | COc1ccc(C(=O)CNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(18)16-9-11(17)10-6-7-12(19-4)13(8-10)20-5/h6-8H,9H2,1-5H3,(H,16,18) |
| InChIKey | WNWMIXHYCXSYPI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |