C14H18N2O5 — CID 21064712
methyl 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyridine-3-carboxylate (PubChem CID 21064712) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 21064712 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | methyl 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)CNC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C14H18N2O5/c1-14(2,3)21-13(19)16-8-11(17)10-6-5-9(7-15-10)12(18)20-4/h5-7H,8H2,1-4H3,(H,16,19) |
| InChIKey | FPNRPZSXDOEGBG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |