C10H14N2O3S — CID 165467941
tert-butyl N-[2-oxo-2-(1,2-thiazol-4-yl)ethyl]carbamate (PubChem CID 165467941) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-(1,2-thiazol-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-(1,2-thiazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 165467941 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | tert-butyl N-[2-oxo-2-(1,2-thiazol-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)c1cnsc1 |
| InChI | InChI=1S/C10H14N2O3S/c1-10(2,3)15-9(14)11-5-8(13)7-4-12-16-6-7/h4,6H,5H2,1-3H3,(H,11,14) |
| InChIKey | NVJJMQTTYQTHKC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |