C11H15N3O3 — CID 138987299
tert-butyl N-(2-oxo-2-pyrimidin-5-ylethyl)carbamate (PubChem CID 138987299) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-2-pyrimidin-5-ylethyl)carbamate.
| Compound Name | tert-butyl N-(2-oxo-2-pyrimidin-5-ylethyl)carbamate |
|---|---|
| PubChem CID | 138987299 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | tert-butyl N-(2-oxo-2-pyrimidin-5-ylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)c1cncnc1 |
| InChI | InChI=1S/C11H15N3O3/c1-11(2,3)17-10(16)14-6-9(15)8-4-12-7-13-5-8/h4-5,7H,6H2,1-3H3,(H,14,16) |
| InChIKey | UREOAKAZYUGOEX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |