C17H23NO7 — CID 58604122
dimethyl 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzene-1,3-dicarboxylate (PubChem CID 58604122) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is dimethyl 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58604122 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | dimethyl 5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCNC(=O)OC(C)(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H23NO7/c1-17(2,3)25-16(21)18-6-7-24-13-9-11(14(19)22-4)8-12(10-13)15(20)23-5/h8-10H,6-7H2,1-5H3,(H,18,21) |
| InChIKey | MAJVXRDYLIPPBF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|