C21H33NO8 — CID 177055235
methyl 4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]benzoate (PubChem CID 177055235) has the molecular formula C21H33NO8 and a molecular weight of 427.49 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 177055235 |
| Molecular Formula | C21H33NO8 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | methyl 4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOCCOCCOCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO8/c1-21(2,3)30-20(24)22-9-10-26-11-12-27-13-14-28-15-16-29-18-7-5-17(6-8-18)19(23)25-4/h5-8H,9-16H2,1-4H3,(H,22,24) |
| InChIKey | XMZZGQCZZZGJHH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|