C20H32N2O5 — CID 144947801
tert-butyl N-[3-[5-(4-carbamoylphenoxy)pentoxy]propyl]carbamate (PubChem CID 144947801) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl N-[3-[5-(4-carbamoylphenoxy)pentoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-(4-carbamoylphenoxy)pentoxy]propyl]carbamate |
|---|---|
| PubChem CID | 144947801 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | tert-butyl N-[3-[5-(4-carbamoylphenoxy)pentoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOCCCCCOc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H32N2O5/c1-20(2,3)27-19(24)22-12-7-14-25-13-5-4-6-15-26-17-10-8-16(9-11-17)18(21)23/h8-11H,4-7,12-15H2,1-3H3,(H2,21,23)(H,22,24) |
| InChIKey | XIVUJFDGYDYTJC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|