C23H31NO4 — CID 167437352
tert-butyl N-[3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]propyl]carbamate (PubChem CID 167437352) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 167437352 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | tert-butyl N-[3-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(C(C)(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-22(2,3)28-21(26)24-15-6-16-27-20-13-9-18(10-14-20)23(4,5)17-7-11-19(25)12-8-17/h7-14,25H,6,15-16H2,1-5H3,(H,24,26) |
| InChIKey | ULOCGOVAAFWSAV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|