C30H36N6O4 — CID 167437241
tert-butyl N-[3-[4-[2-[4-[[2-(triazol-1-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]propyl]carbamate (PubChem CID 167437241) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[4-[[2-(triazol-1-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[4-[[2-(triazol-1-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 167437241 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[4-[[2-(triazol-1-yl)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(C(C)(C)c2ccc(OCc3ccnc(-n4ccnn4)n3)cc2)cc1 |
| InChI | InChI=1S/C30H36N6O4/c1-29(2,3)40-28(37)32-16-6-20-38-25-11-7-22(8-12-25)30(4,5)23-9-13-26(14-10-23)39-21-24-15-17-31-27(34-24)36-19-18-33-35-36/h7-15,17-19H,6,16,20-21H2,1-5H3,(H,32,37) |
| InChIKey | VWBSAHKFEPJSMD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|