C14H22N2O3S — CID 23525758
tert-butyl N-[3-[4-(sulfanylamino)phenoxy]propyl]carbamate (PubChem CID 23525758) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(sulfanylamino)phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(sulfanylamino)phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 23525758 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl N-[3-[4-(sulfanylamino)phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(NS)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-14(2,3)19-13(17)15-9-4-10-18-12-7-5-11(16-20)6-8-12/h5-8,16,20H,4,9-10H2,1-3H3,(H,15,17) |
| InChIKey | XKYXFONSMZWGQK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|