C16H25NO4 — CID 162639917
tert-butyl N-[2-[4-(3-hydroxypropyl)phenoxy]ethyl]carbamate (PubChem CID 162639917) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(3-hydroxypropyl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(3-hydroxypropyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 162639917 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl N-[2-[4-(3-hydroxypropyl)phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-16(2,3)21-15(19)17-10-12-20-14-8-6-13(7-9-14)5-4-11-18/h6-9,18H,4-5,10-12H2,1-3H3,(H,17,19) |
| InChIKey | QDHMAZWBMIQIQD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|