C22H38N2O3 — CID 142694596
tert-butyl N-[4-[4-[2-(pentan-3-ylamino)ethoxy]phenyl]butyl]carbamate (PubChem CID 142694596) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-(pentan-3-ylamino)ethoxy]phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-(pentan-3-ylamino)ethoxy]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 142694596 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | tert-butyl N-[4-[4-[2-(pentan-3-ylamino)ethoxy]phenyl]butyl]carbamate |
| SMILES | CCC(CC)NCCOc1ccc(CCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O3/c1-6-19(7-2)23-16-17-26-20-13-11-18(12-14-20)10-8-9-15-24-21(25)27-22(3,4)5/h11-14,19,23H,6-10,15-17H2,1-5H3,(H,24,25) |
| InChIKey | VMAMSWXSGWBMPB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|