C25H44N2O9 — CID 67367671
tert-butyl N-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamate (PubChem CID 67367671) has the molecular formula C25H44N2O9 and a molecular weight of 516.63 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 67367671 |
| Molecular Formula | C25H44N2O9 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | tert-butyl N-[4-[4-[2-[bis[(2R,3S)-2,3,4-trihydroxybutyl]amino]ethoxy]phenyl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCc1ccc(OCCN(C[C@@H](O)[C@@H](O)CO)C[C@@H](O)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C25H44N2O9/c1-25(2,3)36-24(34)26-11-5-4-6-18-7-9-19(10-8-18)35-13-12-27(14-20(30)22(32)16-28)15-21(31)23(33)17-29/h7-10,20-23,28-33H,4-6,11-17H2,1-3H3,(H,26,34)/t20-,21-,22+,23+/m1/s1 |
| InChIKey | SATNPYAARIWRRQ-LUKWVAJMSA-N |
| XLogP | -0.36 |
| TPSA | 172.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|