C24H44N2O10 — CID 162060619
(2R,3S)-4-[2-[4-(4-aminobutyl)phenoxy]ethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol;(1R)-1-[(2S)-oxiran-2-yl]ethane-1,2-diol (PubChem CID 162060619) has the molecular formula C24H44N2O10 and a molecular weight of 520.62 g/mol. Its IUPAC name is (2R,3S)-4-[2-[4-(4-aminobutyl)phenoxy]ethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol;(1R)-1-[(2S)-oxiran-2-yl]ethane-1,2-diol.
| Compound Name | (2R,3S)-4-[2-[4-(4-aminobutyl)phenoxy]ethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol;(1R)-1-[(2S)-oxiran-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 162060619 |
| Molecular Formula | C24H44N2O10 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (2R,3S)-4-[2-[4-(4-aminobutyl)phenoxy]ethyl-[(2S,3R)-2,3,4-trihydroxybutyl]amino]butane-1,2,3-triol;(1R)-1-[(2S)-oxiran-2-yl]ethane-1,2-diol |
| SMILES | NCCCCc1ccc(OCCN(C[C@H](O)[C@H](O)CO)C[C@H](O)[C@H](O)CO)cc1.OC[C@@H](O)[C@@H]1CO1 |
| InChI | InChI=1S/C20H36N2O7.C4H8O3/c21-8-2-1-3-15-4-6-16(7-5-15)29-10-9-22(11-17(25)19(27)13-23)12-18(26)20(28)14-24;5-1-3(6)4-2-7-4/h4-7,17-20,23-28H,1-3,8-14,21H2;3-6H,1-2H2/t17-,18-,19+,20+;3-,4+/m01/s1 |
| InChIKey | YZUCYPJHKKYTRN-PPMIYNQASA-N |
| XLogP | -3.18 |
| TPSA | 212.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|