C41H64N2O10 — CID 157398980
2-[2-(4-pentylphenoxy)ethoxy]ethyl 6-[2-[2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]ethoxy]ethoxycarbonylamino]hexanoate (PubChem CID 157398980) has the molecular formula C41H64N2O10 and a molecular weight of 744.97 g/mol. Its IUPAC name is 2-[2-(4-pentylphenoxy)ethoxy]ethyl 6-[2-[2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]ethoxy]ethoxycarbonylamino]hexanoate.
| Compound Name | 2-[2-(4-pentylphenoxy)ethoxy]ethyl 6-[2-[2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]ethoxy]ethoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 157398980 |
| Molecular Formula | C41H64N2O10 |
| Molecular Weight | 744.97 g/mol |
| Exact Mass | 744.46 |
| IUPAC Name | 2-[2-(4-pentylphenoxy)ethoxy]ethyl 6-[2-[2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]ethoxy]ethoxycarbonylamino]hexanoate |
| SMILES | CCCCCc1ccc(OCCOCCOC(=O)CCCCCNC(=O)OCCOCCOc2ccc(CCCCNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C41H64N2O10/c1-5-6-8-13-34-16-20-36(21-17-34)49-30-26-47-28-32-51-38(44)15-9-7-11-24-42-39(45)52-33-29-48-27-31-50-37-22-18-35(19-23-37)14-10-12-25-43-40(46)53-41(2,3)4/h16-23H,5-15,24-33H2,1-4H3,(H,42,45)(H,43,46) |
| InChIKey | IJNAFZOQZYFXMM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.97 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|