C34H54N4O6 — CID 121385186
1-[2-[2-(4-butylphenoxy)ethoxy]ethyl]-3-[4-[2-[2-(4-butylphenoxy)ethoxy]ethylcarbamoylamino]butyl]urea (PubChem CID 121385186) has the molecular formula C34H54N4O6 and a molecular weight of 614.83 g/mol. Its IUPAC name is 1-[2-[2-(4-butylphenoxy)ethoxy]ethyl]-3-[4-[2-[2-(4-butylphenoxy)ethoxy]ethylcarbamoylamino]butyl]urea.
| Compound Name | 1-[2-[2-(4-butylphenoxy)ethoxy]ethyl]-3-[4-[2-[2-(4-butylphenoxy)ethoxy]ethylcarbamoylamino]butyl]urea |
|---|---|
| PubChem CID | 121385186 |
| Molecular Formula | C34H54N4O6 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | 1-[2-[2-(4-butylphenoxy)ethoxy]ethyl]-3-[4-[2-[2-(4-butylphenoxy)ethoxy]ethylcarbamoylamino]butyl]urea |
| SMILES | CCCCc1ccc(OCCOCCNC(=O)NCCCCNC(=O)NCCOCCOc2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C34H54N4O6/c1-3-5-9-29-11-15-31(16-12-29)43-27-25-41-23-21-37-33(39)35-19-7-8-20-36-34(40)38-22-24-42-26-28-44-32-17-13-30(14-18-32)10-6-4-2/h11-18H,3-10,19-28H2,1-2H3,(H2,35,37,39)(H2,36,38,40) |
| InChIKey | WLCXRIOAIZPRRO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|