C35H55N3O8 — CID 157398979
2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethyl 6-[2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethoxycarbonylamino]hexanoate (PubChem CID 157398979) has the molecular formula C35H55N3O8 and a molecular weight of 645.84 g/mol. Its IUPAC name is 2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethyl 6-[2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethoxycarbonylamino]hexanoate.
| Compound Name | 2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethyl 6-[2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 157398979 |
| Molecular Formula | C35H55N3O8 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.40 |
| IUPAC Name | 2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethyl 6-[2-[2-[4-(4-aminobutyl)phenoxy]ethoxy]ethoxycarbonylamino]hexanoate |
| SMILES | NCCCCc1ccc(OCCOCCOC(=O)CCCCCNC(=O)OCCOCCOc2ccc(CCCCN)cc2)cc1 |
| InChI | InChI=1S/C35H55N3O8/c36-19-5-3-8-30-11-15-32(16-12-30)43-26-22-41-24-28-45-34(39)10-2-1-7-21-38-35(40)46-29-25-42-23-27-44-33-17-13-31(14-18-33)9-4-6-20-37/h11-18H,1-10,19-29,36-37H2,(H,38,40) |
| InChIKey | OFUNCJZFVOPKSE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|