C15H21BrN2O4 — CID 8860174
2-(4-bromophenoxy)ethyl 6-(carbamoylamino)hexanoate (PubChem CID 8860174) has the molecular formula C15H21BrN2O4 and a molecular weight of 373.25 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 6-(carbamoylamino)hexanoate.
| Compound Name | 2-(4-bromophenoxy)ethyl 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8860174 |
| Molecular Formula | C15H21BrN2O4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 6-(carbamoylamino)hexanoate |
| SMILES | NC(=O)NCCCCCC(=O)OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O4/c16-12-5-7-13(8-6-12)21-10-11-22-14(19)4-2-1-3-9-18-15(17)20/h5-8H,1-4,9-11H2,(H3,17,18,20) |
| InChIKey | DUSORXXIYISGFM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|