C26H43NO5 — CID 58309812
methyl 8-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxycarbonylamino]octanoate (PubChem CID 58309812) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is methyl 8-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxycarbonylamino]octanoate.
| Compound Name | methyl 8-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 58309812 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | methyl 8-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxycarbonylamino]octanoate |
| SMILES | COC(=O)CCCCCCCNC(=O)OCCOc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H43NO5/c1-25(2,3)20-26(4,5)21-13-15-22(16-14-21)31-18-19-32-24(29)27-17-11-9-7-8-10-12-23(28)30-6/h13-16H,7-12,17-20H2,1-6H3,(H,27,29) |
| InChIKey | ZQZBVJHRELFICQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|