C16H31NO4 — CID 91716734
butyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate (PubChem CID 91716734) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is butyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate.
| Compound Name | butyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 91716734 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | butyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate |
| SMILES | CCCCOC(=O)CCCCCNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C16H31NO4/c1-5-6-12-20-14(18)10-8-7-9-11-17-15(19)21-13-16(2,3)4/h5-13H2,1-4H3,(H,17,19) |
| InChIKey | PCMRDZDTSJKLII-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|