C21H41NO4 — CID 91739008
nonyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate (PubChem CID 91739008) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is nonyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate.
| Compound Name | nonyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 91739008 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | nonyl 6-(2,2-dimethylpropoxycarbonylamino)hexanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C21H41NO4/c1-5-6-7-8-9-10-14-17-25-19(23)15-12-11-13-16-22-20(24)26-18-21(2,3)4/h5-18H2,1-4H3,(H,22,24) |
| InChIKey | VIAHMHQXEBJGEA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|