C17H33NO4 — CID 91709747
octyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate (PubChem CID 91709747) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is octyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate.
| Compound Name | octyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91709747 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | octyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCOC(=O)CCNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C17H33NO4/c1-5-6-7-8-9-10-13-21-15(19)11-12-18-16(20)22-14-17(2,3)4/h5-14H2,1-4H3,(H,18,20) |
| InChIKey | VHMURJJULPOQJD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|