C19H37NO4 — CID 91709553
decyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate (PubChem CID 91709553) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is decyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate.
| Compound Name | decyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91709553 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | decyl 3-(2,2-dimethylpropoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCCCOC(=O)CCNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C19H37NO4/c1-5-6-7-8-9-10-11-12-15-23-17(21)13-14-20-18(22)24-16-19(2,3)4/h5-16H2,1-4H3,(H,20,22) |
| InChIKey | FDGPFQCWYLFVBT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|