About tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate
tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate (PubChem CID 91721442) has the molecular formula C21H37NO4
and a molecular weight of 367.53 g/mol. Its IUPAC name is tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate |
| PubChem CID | 91721442 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate |
| SMILES | C#CCOC(=O)NCCC(=O)OCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H37NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-25-20(23)16-17-22-21(24)26-18-4-2/h2H,3,5-19H2,1H3,(H,22,24) |
| InChIKey | DKLKKJUVOXCVRY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate?
The IUPAC name of tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate (CID 91721442) is tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate.
What is the SMILES notation for tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate?
The canonical SMILES for tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate is C#CCOC(=O)NCCC(=O)OCCCCCCCCCCCCCC.
What is the InChIKey of tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate?
The InChIKey is DKLKKJUVOXCVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-25-20(23)16-17-22-21(24)26-18-4-2/h2H,3,5-19H2,1H3,(H,22,24).
What are the key properties of tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate?
tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate has a molecular weight of 367.53 g/mol, XLogP of 4.98, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl 3-(prop-2-ynoxycarbonylamino)propanoate is sourced from PubChem (CID 91721442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).