C34H50O4 — CID 71386574
bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate (PubChem CID 71386574) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate.
| Compound Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate |
|---|---|
| PubChem CID | 71386574 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(=O)CCCCC(=O)Oc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H50O4/c1-31(2,3)23-33(7,8)25-15-19-27(20-16-25)37-29(35)13-11-12-14-30(36)38-28-21-17-26(18-22-28)34(9,10)24-32(4,5)6/h15-22H,11-14,23-24H2,1-10H3 |
| InChIKey | SZONIHPQSYNFGK-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|