C16H21F3O2 — CID 71672718
[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 71672718) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is [4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71672718 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3O2/c1-14(2,3)10-15(4,5)11-6-8-12(9-7-11)21-13(20)16(17,18)19/h6-9H,10H2,1-5H3 |
| InChIKey | MFTVUDOHSREJKG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|