C53H72O6 — CID 23302106
bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2-bis[(3-tert-butyl-5-hydroxyphenyl)methyl]propanedioate (PubChem CID 23302106) has the molecular formula C53H72O6 and a molecular weight of 805.15 g/mol. Its IUPAC name is bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2-bis[(3-tert-butyl-5-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2-bis[(3-tert-butyl-5-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 23302106 |
| Molecular Formula | C53H72O6 |
| Molecular Weight | 805.15 g/mol |
| Exact Mass | 804.53 |
| IUPAC Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2,2-bis[(3-tert-butyl-5-hydroxyphenyl)methyl]propanedioate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(=O)C(Cc2cc(O)cc(C(C)(C)C)c2)(Cc2cc(O)cc(C(C)(C)C)c2)C(=O)Oc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C53H72O6/c1-47(2,3)33-51(13,14)37-17-21-43(22-18-37)58-45(56)53(31-35-25-39(49(7,8)9)29-41(54)27-35,32-36-26-40(50(10,11)12)30-42(55)28-36)46(57)59-44-23-19-38(20-24-44)52(15,16)34-48(4,5)6/h17-30,54-55H,31-34H2,1-16H3 |
| InChIKey | JUGQREOPZZQVGA-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.15 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|