C62H84N6O5 — CID 175306534
bis(2H-benzotriazole);bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 175306534) has the molecular formula C62H84N6O5 and a molecular weight of 993.39 g/mol. Its IUPAC name is bis(2H-benzotriazole);bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(2H-benzotriazole);bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 175306534 |
| Molecular Formula | C62H84N6O5 |
| Molecular Weight | 993.39 g/mol |
| Exact Mass | 992.65 |
| IUPAC Name | bis(2H-benzotriazole);bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CCCCC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(C(=O)Oc1ccc(C(C)(C)CC(C)(C)C)cc1)C(=O)Oc1ccc(C(C)(C)CC(C)(C)C)cc1.c1ccc2n[nH]nc2c1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C50H74O5.2C6H5N3/c1-18-19-28-50(31-34-29-39(46(8,9)10)41(51)40(30-34)47(11,12)13,42(52)54-37-24-20-35(21-25-37)48(14,15)32-44(2,3)4)43(53)55-38-26-22-36(23-27-38)49(16,17)33-45(5,6)7;2*1-2-4-6-5(3-1)7-9-8-6/h20-27,29-30,51H,18-19,28,31-33H2,1-17H3;2*1-4H,(H,7,8,9) |
| InChIKey | IHNBVIIEDCWVTG-UHFFFAOYSA-N |
| XLogP | 15.26 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.39 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|