C23H30O3 — CID 139663069
phenyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 139663069) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is phenyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | phenyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 139663069 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | phenyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(CCC(=O)Oc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H30O3/c1-22(2,3)18-14-16(15-19(21(18)25)23(4,5)6)12-13-20(24)26-17-10-8-7-9-11-17/h7-11,14-15,25H,12-13H2,1-6H3 |
| InChIKey | CWZSUOTWEZVSMR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|