C19H33O3P — CID 175291494
ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phosphane (PubChem CID 175291494) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phosphane.
| Compound Name | ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phosphane |
|---|---|
| PubChem CID | 175291494 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phosphane |
| SMILES | CCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.P |
| InChI | InChI=1S/C19H30O3.H3P/c1-8-22-16(20)10-9-13-11-14(18(2,3)4)17(21)15(12-13)19(5,6)7;/h11-12,21H,8-10H2,1-7H3;1H3 |
| InChIKey | JTIJTHHJVGXZJB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|