C22H38O3 — CID 160740972
butyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;methane (PubChem CID 160740972) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is butyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;methane.
| Compound Name | butyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;methane |
|---|---|
| PubChem CID | 160740972 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | butyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;methane |
| SMILES | C.CCCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34O3.CH4/c1-8-9-12-24-18(22)11-10-15-13-16(20(2,3)4)19(23)17(14-15)21(5,6)7;/h13-14,23H,8-12H2,1-7H3;1H4 |
| InChIKey | RVOODZLXCNUXRR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|