C31H56NO3+ — CID 3487243
decyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl]-dimethylazanium (PubChem CID 3487243) has the molecular formula C31H56NO3+ and a molecular weight of 490.79 g/mol. Its IUPAC name is decyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl]-dimethylazanium.
| Compound Name | decyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 3487243 |
| Molecular Formula | C31H56NO3+ |
| Molecular Weight | 490.79 g/mol |
| Exact Mass | 490.43 |
| IUPAC Name | decyl-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl]-dimethylazanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H55NO3/c1-10-11-12-13-14-15-16-17-20-32(8,9)21-22-35-28(33)19-18-25-23-26(30(2,3)4)29(34)27(24-25)31(5,6)7/h23-24H,10-22H2,1-9H3/p+1 |
| InChIKey | DFCITNRFKNPTFV-UHFFFAOYSA-O |
| XLogP | 7.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.79 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|