C22H38INO3 — CID 12988676
2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl-trimethylazanium iodide (PubChem CID 12988676) has the molecular formula C22H38INO3 and a molecular weight of 491.45 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl-trimethylazanium iodide.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 12988676 |
| Molecular Formula | C22H38INO3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl-trimethylazanium iodide |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCC[N+](C)(C)C)cc(C(C)(C)C)c1O.[I-] |
| InChI | InChI=1S/C22H37NO3.HI/c1-21(2,3)17-14-16(15-18(20(17)25)22(4,5)6)10-11-19(24)26-13-12-23(7,8)9;/h14-15H,10-13H2,1-9H3;1H |
| InChIKey | MEBVRSDEOIFJJA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|