C19H32BrNO3 — CID 139775534
2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl-trimethylazanium bromide (PubChem CID 139775534) has the molecular formula C19H32BrNO3 and a molecular weight of 402.37 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl-trimethylazanium bromide.
| Compound Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 139775534 |
| Molecular Formula | C19H32BrNO3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethyl-trimethylazanium bromide |
| SMILES | Cc1cc(CCC(=O)OCC[N+](C)(C)C)cc(C(C)(C)C)c1O.[Br-] |
| InChI | InChI=1S/C19H31NO3.BrH/c1-14-12-15(13-16(18(14)22)19(2,3)4)8-9-17(21)23-11-10-20(5,6)7;/h12-13H,8-11H2,1-7H3;1H |
| InChIKey | KVLCIBKENSSGLB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|