C20H32O3 — CID 54074371
4-methylpentyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 54074371) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 4-methylpentyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | 4-methylpentyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 54074371 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 4-methylpentyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCCCC(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H32O3/c1-14(2)8-7-11-23-18(21)10-9-16-12-15(3)19(22)17(13-16)20(4,5)6/h12-14,22H,7-11H2,1-6H3 |
| InChIKey | MIQRUNONQWTBGX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|