C35H62O3 — CID 22561152
7-propylpentadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 22561152) has the molecular formula C35H62O3 and a molecular weight of 530.88 g/mol. Its IUPAC name is 7-propylpentadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 7-propylpentadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 22561152 |
| Molecular Formula | C35H62O3 |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.47 |
| IUPAC Name | 7-propylpentadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCCCCCCCC(CCC)CCCCCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H62O3/c1-9-11-12-13-14-17-21-28(20-10-2)22-18-15-16-19-25-38-32(36)24-23-29-26-30(34(3,4)5)33(37)31(27-29)35(6,7)8/h26-28,37H,9-25H2,1-8H3 |
| InChIKey | DDOUDNPCOLDOHV-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|