C34H52O4 — CID 175394053
hexyl 3-[3-tert-butyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoate (PubChem CID 175394053) has the molecular formula C34H52O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is hexyl 3-[3-tert-butyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoate.
| Compound Name | hexyl 3-[3-tert-butyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 175394053 |
| Molecular Formula | C34H52O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | hexyl 3-[3-tert-butyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoate |
| SMILES | CCCCCCOC(=O)CCc1cc(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H52O4/c1-11-12-13-14-17-38-29(35)16-15-23-18-25(30(36)26(20-23)32(2,3)4)19-24-21-27(33(5,6)7)31(37)28(22-24)34(8,9)10/h18,20-22,36-37H,11-17,19H2,1-10H3 |
| InChIKey | SYYACWXWNSVQNV-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|