C31H48O4 — CID 158452826
octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phenol (PubChem CID 158452826) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phenol.
| Compound Name | octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phenol |
|---|---|
| PubChem CID | 158452826 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | octyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;phenol |
| SMILES | CCCCCCCCOC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Oc1ccccc1 |
| InChI | InChI=1S/C25H42O3.C6H6O/c1-8-9-10-11-12-13-16-28-22(26)15-14-19-17-20(24(2,3)4)23(27)21(18-19)25(5,6)7;7-6-4-2-1-3-5-6/h17-18,27H,8-16H2,1-7H3;1-5,7H |
| InChIKey | HEEZWOPHBKEWOF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|