C27H38O3 — CID 140971201
octyl 3-(3-tert-butyl-4-hydroxy-5-phenylphenyl)propanoate (PubChem CID 140971201) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is octyl 3-(3-tert-butyl-4-hydroxy-5-phenylphenyl)propanoate.
| Compound Name | octyl 3-(3-tert-butyl-4-hydroxy-5-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 140971201 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | octyl 3-(3-tert-butyl-4-hydroxy-5-phenylphenyl)propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1cc(-c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H38O3/c1-5-6-7-8-9-13-18-30-25(28)17-16-21-19-23(22-14-11-10-12-15-22)26(29)24(20-21)27(2,3)4/h10-12,14-15,19-20,29H,5-9,13,16-18H2,1-4H3 |
| InChIKey | DYMDLZPQGJOQSK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|