C27H37N2O3+ — CID 137064162
octyl 3-[3-(8-aza-7-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-7-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate (PubChem CID 137064162) has the molecular formula C27H37N2O3+ and a molecular weight of 437.60 g/mol. Its IUPAC name is octyl 3-[3-(8-aza-7-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-7-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate.
| Compound Name | octyl 3-[3-(8-aza-7-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-7-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 137064162 |
| Molecular Formula | C27H37N2O3+ |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | octyl 3-[3-(8-aza-7-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-7-yl)-5-tert-butyl-4-hydroxyphenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1cc([N+]2=Nc3ccccc32)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-5-6-7-8-9-12-17-32-25(30)16-15-20-18-21(27(2,3)4)26(31)24(19-20)29-23-14-11-10-13-22(23)28-29/h10-11,13-14,18-19H,5-9,12,15-17H2,1-4H3/p+1 |
| InChIKey | BGBGQOBTMRKLOK-UHFFFAOYSA-O |
| XLogP | 7.46 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|