C25H42O3 — CID 11486113
2-ethylhexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 11486113) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-ethylhexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-ethylhexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 11486113 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-ethylhexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCCCC(CC)COC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H42O3/c1-9-11-12-18(10-2)17-28-22(26)14-13-19-15-20(24(3,4)5)23(27)21(16-19)25(6,7)8/h15-16,18,27H,9-14,17H2,1-8H3 |
| InChIKey | YSLFJMFSTOJEDL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |