C28H38O5 — CID 162200328
[3-tert-butyl-5-[3-(2-ethylhexoxy)-3-oxopropyl]-2-hydroxyphenyl] benzoate (PubChem CID 162200328) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is [3-tert-butyl-5-[3-(2-ethylhexoxy)-3-oxopropyl]-2-hydroxyphenyl] benzoate.
| Compound Name | [3-tert-butyl-5-[3-(2-ethylhexoxy)-3-oxopropyl]-2-hydroxyphenyl] benzoate |
|---|---|
| PubChem CID | 162200328 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | [3-tert-butyl-5-[3-(2-ethylhexoxy)-3-oxopropyl]-2-hydroxyphenyl] benzoate |
| SMILES | CCCCC(CC)COC(=O)CCc1cc(OC(=O)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H38O5/c1-6-8-12-20(7-2)19-32-25(29)16-15-21-17-23(28(3,4)5)26(30)24(18-21)33-27(31)22-13-10-9-11-14-22/h9-11,13-14,17-18,20,30H,6-8,12,15-16,19H2,1-5H3 |
| InChIKey | YUTKBORBBPORCN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|