C21H32O3 — CID 21353023
butyl 3-[3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)phenyl]propanoate (PubChem CID 21353023) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is butyl 3-[3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)phenyl]propanoate.
| Compound Name | butyl 3-[3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)phenyl]propanoate |
|---|---|
| PubChem CID | 21353023 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | butyl 3-[3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)phenyl]propanoate |
| SMILES | CCCCOC(=O)CCc1cc(C=C(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H32O3/c1-7-8-11-24-19(22)10-9-16-13-17(12-15(2)3)20(23)18(14-16)21(4,5)6/h12-14,23H,7-11H2,1-6H3 |
| InChIKey | YKGWFTOTYHUVMU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|