C36H50O8 — CID 175496216
bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl] oxalate (PubChem CID 175496216) has the molecular formula C36H50O8 and a molecular weight of 610.79 g/mol. Its IUPAC name is bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl] oxalate.
| Compound Name | bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl] oxalate |
|---|---|
| PubChem CID | 175496216 |
| Molecular Formula | C36H50O8 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl] oxalate |
| SMILES | CC(C)(C)c1cc(CCC(=O)OC(=O)C(=O)OC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H50O8/c1-33(2,3)23-17-21(18-24(29(23)39)34(4,5)6)13-15-27(37)43-31(41)32(42)44-28(38)16-14-22-19-25(35(7,8)9)30(40)26(20-22)36(10,11)12/h17-20,39-40H,13-16H2,1-12H3 |
| InChIKey | FEDQTSYPNQMEQG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|